EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H32 |
| Net Charge | 0 |
| Average Mass | 212.421 |
| Monoisotopic Mass | 212.25040 |
| SMILES | CCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C15H32/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h13-15H,6-12H2,1-5H3 |
| InChIKey | YFHFHLSMISYUAQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| farnesane (CHEBI:36756) has role plant metabolite (CHEBI:76924) |
| farnesane (CHEBI:36756) is a alkane (CHEBI:18310) |
| farnesane (CHEBI:36756) is a sesquiterpene (CHEBI:35189) |
| Incoming Relation(s) |
| 2,6,10-trimethyldodeca-2,6,10-triene (CHEBI:36534) has parent hydride farnesane (CHEBI:36756) |
| farnesane sesquiterpenoid (CHEBI:36757) has parent hydride farnesane (CHEBI:36756) |
| IUPAC Name |
|---|
| 2,6,10-trimethyldodecane |
| Synonyms | Source |
|---|---|
| farnesane | NIST Chemistry WebBook |
| Farnesan | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| LMPR0103010000 | LIPID MAPS |
| CPD-8764 | MetaCyc |
| US7399323 | Patent |
| US2008098645 | Patent |