EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H37N3O7S |
| Net Charge | 0 |
| Average Mass | 547.674 |
| Monoisotopic Mass | 547.23522 |
| SMILES | [H][C@]12OCC[C@@]1([H])[C@@H](OC(=O)N[C@@H](Cc1ccccc1)[C@H](O)CN(CC(C)C)S(=O)(=O)c1ccc(N)cc1)CO2 |
| InChI | InChI=1S/C27H37N3O7S/c1-18(2)15-30(38(33,34)21-10-8-20(28)9-11-21)16-24(31)23(14-19-6-4-3-5-7-19)29-27(32)37-25-17-36-26-22(25)12-13-35-26/h3-11,18,22-26,31H,12-17,28H2,1-2H3,(H,29,32)/t22-,23-,24+,25-,26+/m0/s1 |
| InChIKey | CJBJHOAVZSMMDJ-HEXNFIEUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| darunavir (CHEBI:367163) has role antiviral drug (CHEBI:36044) |
| darunavir (CHEBI:367163) has role HIV protease inhibitor (CHEBI:35660) |
| darunavir (CHEBI:367163) is a carbamate ester (CHEBI:23003) |
| darunavir (CHEBI:367163) is a furofuran (CHEBI:47790) |
| darunavir (CHEBI:367163) is a sulfonamide (CHEBI:35358) |
| Incoming Relation(s) |
| Prezcobix (CHEBI:90928) has part darunavir (CHEBI:367163) |
| IUPAC Name |
|---|
| (3R,3aS,6aR)-hexahydrofuro[2,3-b]furan-3-yl [(2S,3R)-4-{[(4-aminophenyl)sulfonyl](2-methylpropyl)amino}-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| INNs | Source |
|---|---|
| darunavirum | ChemIDplus |
| darunavir | ChemIDplus |
| Synonyms | Source |
|---|---|
| (3R,3AS,6AR)-HEXAHYDROFURO[2,3-B]FURAN-3-YL(1S,2R)-3-[[(4-AMINOPHENYL)SULFONYL](ISOBUTYL)AMINO]-1-BENZYL-2-HYDROXYPROPYLCARBAMATE | PDBeChem |
| (3R,3aS,6aR)-tetrahydro-2H-furo[2,3-b]furan-3-yl (2S,3R)-4-(4-amino-N-isobutylphenylsulfonamido)-3-hydroxy-1-phenylbutan-2-ylcarbamate | ChEMBL |
| TMC114 | ChEMBL |
| {(1S,2R)-3-[(4-Amino-benzenesulfonyl)-isobutyl-amino]-1-benzyl-2-hydroxy-propyl}-carbamic acid (3R,3aS,6aR)-(hexahydro-furo[2,3-b]furan-3-yl) ester | ChEMBL |
| (3R,3aS,6aR)-tetrahydro-2H-furo[2,3-b]furan-3-yl (2S,3R)-4-(4-amino-N-neopentylphenylsulfonamido)-3-hydroxy-1-phenylbutan-2-ylcarbamate | ChEMBL |
| [(S)-3-[(4-Amino-benzenesulfonyl)-isobutyl-amino]-2-hydroxy-1-((R)-phenylmethyl)-propyl]-carbamic acid (3R,3aS,6aR)-(hexahydro-furo[2,3-b]furan-3-yl) ester | ChEMBL |
| Citations |
|---|