EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N4O2 |
| Net Charge | 0 |
| Average Mass | 314.389 |
| Monoisotopic Mass | 314.17428 |
| SMILES | CCOCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)O |
| InChI | InChI=1S/C17H22N4O2/c1-4-23-9-13-20-14-15(21(13)10-17(2,3)22)11-7-5-6-8-12(11)19-16(14)18/h5-8,22H,4,9-10H2,1-3H3,(H2,18,19) |
| InChIKey | BXNMTOQRYBFHNZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resiquimod (CHEBI:36706) has role anti-HBV agent (CHEBI:64951) |
| resiquimod (CHEBI:36706) has role antineoplastic agent (CHEBI:35610) |
| resiquimod (CHEBI:36706) has role antiviral agent (CHEBI:22587) |
| resiquimod (CHEBI:36706) is a imidazoquinoline (CHEBI:38776) |
| IUPAC Name |
|---|
| 1-[4-amino-2-(ethoxymethyl)-1H-imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-ol |
| Synonyms | Source |
|---|---|
| CD-11301 | ChEMBL |
| CD11301 | ChEMBL |
| R 848 | ChemIDplus |
| R-848 | ChemIDplus |
| R848 | ChEMBL |
| Resiquimod | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9792901 | Beilstein |
| CAS:144875-48-9 | ChemIDplus |
| Citations |
|---|