EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:36704 - imiquimod
| Formula | C14H16N4 |
| Net Charge | 0 |
| Average Mass | 240.310 |
| Monoisotopic Mass | 240.13750 |
| SMILES | CC(C)Cn1cnc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C14H16N4/c1-9(2)7-18-8-16-12-13(18)10-5-3-4-6-11(10)17-14(12)15/h3-6,8-9H,7H2,1-2H3,(H2,15,17) |
| InChIKey | DOUYETYNHWVLEO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antiviral agent A substance that destroys or inhibits replication of viruses. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. interferon inducer An agent that promotes the production and release of interferons. hepatoprotective agent Any compound that is able to prevent damage to the liver. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imiquimod (CHEBI:36704) has role anti-HBV agent (CHEBI:64951) |
| imiquimod (CHEBI:36704) has role antileishmanial agent (CHEBI:70868) |
| imiquimod (CHEBI:36704) has role antimalarial (CHEBI:38068) |
| imiquimod (CHEBI:36704) has role antineoplastic agent (CHEBI:35610) |
| imiquimod (CHEBI:36704) has role antiviral agent (CHEBI:22587) |
| imiquimod (CHEBI:36704) has role hepatoprotective agent (CHEBI:62868) |
| imiquimod (CHEBI:36704) has role interferon inducer (CHEBI:36710) |
| imiquimod (CHEBI:36704) is a imidazoquinoline (CHEBI:38776) |
| imiquimod (CHEBI:36704) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 1-(2-methylpropyl)-1H-imidazo[4,5-c]quinolin-4-amine |
| INNs | Source |
|---|---|
| imiquimod | WHO MedNet |
| imiquimod | WHO MedNet |
| imiquimod | WHO MedNet |
| imiquimodum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-isobutyl-1H-imidazo[4,5-c]quinolin-4-amine | IUPAC |
| 4-Amino-1-isobutyl-1H-imidazo(4,5-c)quinoline | ChemIDplus |
| Imiquimod | ChemIDplus |
| NSC-369100 | ChEMBL |
| NSC-759651 | ChEMBL |
| R 837 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Zartra | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1429 | DrugCentral |
| AU2005320890 | Patent |
| DB00724 | DrugBank |
| EP1831219 | Patent |
| Imiquimod | Wikipedia |
| KR20070102652 | Patent |
| LSM-5408 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7710060 | Reaxys |
| CAS:99011-02-6 | ChemIDplus |
| Citations |
|---|