EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N4 |
| Net Charge | 0 |
| Average Mass | 240.310 |
| Monoisotopic Mass | 240.13750 |
| SMILES | CC(C)Cn1cnc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C14H16N4/c1-9(2)7-18-8-16-12-13(18)10-5-3-4-6-11(10)17-14(12)15/h3-6,8-9H,7H2,1-2H3,(H2,15,17) |
| InChIKey | DOUYETYNHWVLEO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. interferon inducer An agent that promotes the production and release of interferons. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imiquimod (CHEBI:36704) has role anti-HBV agent (CHEBI:64951) |
| imiquimod (CHEBI:36704) has role antileishmanial agent (CHEBI:70868) |
| imiquimod (CHEBI:36704) has role antimalarial (CHEBI:38068) |
| imiquimod (CHEBI:36704) has role antineoplastic agent (CHEBI:35610) |
| imiquimod (CHEBI:36704) has role antiviral agent (CHEBI:22587) |
| imiquimod (CHEBI:36704) has role hepatoprotective agent (CHEBI:62868) |
| imiquimod (CHEBI:36704) has role interferon inducer (CHEBI:36710) |
| imiquimod (CHEBI:36704) is a imidazoquinoline (CHEBI:38776) |
| IUPAC Name |
|---|
| 1-(2-methylpropyl)-1H-imidazo[4,5-c]quinolin-4-amine |
| INNs | Source |
|---|---|
| imiquimod | WHO MedNet |
| imiquimod | WHO MedNet |
| imiquimod | WHO MedNet |
| imiquimodum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-isobutyl-1H-imidazo[4,5-c]quinolin-4-amine | IUPAC |
| 4-Amino-1-isobutyl-1H-imidazo(4,5-c)quinoline | ChemIDplus |
| Imiquimod | ChemIDplus |
| NSC-369100 | ChEMBL |
| NSC-759651 | ChEMBL |
| R 837 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Zartra | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1429 | DrugCentral |
| AU2005320890 | Patent |
| DB00724 | DrugBank |
| EP1831219 | Patent |
| Imiquimod | Wikipedia |
| KR20070102652 | Patent |
| LSM-5408 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7710060 | Reaxys |
| CAS:99011-02-6 | ChemIDplus |
| Citations |
|---|