EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO |
| Net Charge | 0 |
| Average Mass | 279.383 |
| Monoisotopic Mass | 279.16231 |
| SMILES | CN(C)CC/C=C1/c2ccccc2COc2ccccc21 |
| InChI | InChI=1S/C19H21NO/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19/h3-6,8-12H,7,13-14H2,1-2H3/b17-11- |
| InChIKey | ODQWQRRAPPTVAG-BOPFTXTBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-doxepin (CHEBI:36691) is a doxepin (CHEBI:4710) |
| IUPAC Names |
|---|
| (3Z)-3-dibenzo[b,e]oxepin-11(6H)-ylidene-N,N-dimethylpropan-1-amine |
| (3E)-3-dibenzo[b,e]oxepin-11(6H)-ylidene-N,N-dimethylpropan-1-amine |
| Manual Xrefs | Databases |
|---|---|
| Doxepin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5056048 | Beilstein |
| Beilstein:4235023 | Beilstein |