EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5O3 |
| Net Charge | -1 |
| Average Mass | 149.125 |
| Monoisotopic Mass | 149.02442 |
| SMILES | O=C([O-])C(=O)c1ccccc1 |
| InChI | InChI=1S/C8H6O3/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5H,(H,10,11)/p-1 |
| InChIKey | FAQJJMHZNSSFSM-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylglyoxylate (CHEBI:36656) has functional parent glyoxylate (CHEBI:36655) |
| phenylglyoxylate (CHEBI:36656) has role human xenobiotic metabolite (CHEBI:76967) |
| phenylglyoxylate (CHEBI:36656) is a glyoxylates (CHEBI:51704) |
| phenylglyoxylate (CHEBI:36656) is conjugate base of phenylglyoxylic acid (CHEBI:18280) |
| Incoming Relation(s) |
| phenylglyoxylic acid (CHEBI:18280) is conjugate acid of phenylglyoxylate (CHEBI:36656) |
| IUPAC Name |
|---|
| oxo(phenyl)acetate |
| Synonyms | Source |
|---|---|
| benzoylformic acid anion | ChEBI |
| phenylglyoxylic acid anion | ChEBI |
| UniProt Name | Source |
|---|---|
| phenylglyoxylate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| PHENYLGLYOXYLATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:328162 | Gmelin |
| Reaxys:3904908 | Reaxys |