EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O2 |
| Net Charge | 0 |
| Average Mass | 136.150 |
| Monoisotopic Mass | 136.05243 |
| SMILES | Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C8H8O2/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3,(H,9,10) |
| InChIKey | ZWLPBLYKEWSWPD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| o-toluic acid (CHEBI:36632) has role xenobiotic metabolite (CHEBI:76206) |
| o-toluic acid (CHEBI:36632) is a methylbenzoic acid (CHEBI:25280) |
| o-toluic acid (CHEBI:36632) is conjugate acid of o-toluate (CHEBI:28872) |
| Incoming Relation(s) |
| o-toluate (CHEBI:28872) is conjugate base of o-toluic acid (CHEBI:36632) |
| IUPAC Name |
|---|
| 2-methylbenzoic acid |
| Synonyms | Source |
|---|---|
| 2-Methylbenzoic acid | KEGG COMPOUND |
| 2-toluic acid | ChEBI |
| Orthotoluic acid | ChEBI |
| o-Toluic Acid | KEGG COMPOUND |
| o-Toluylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C07215 | KEGG COMPOUND |
| HMDB0002340 | HMDB |
| O-Toluic_acid | Wikipedia |
| Citations |
|---|