EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6O3 |
| Net Charge | 0 |
| Average Mass | 90.078 |
| Monoisotopic Mass | 90.03169 |
| SMILES | COC(=O)OC |
| InChI | InChI=1S/C3H6O3/c1-5-3(4)6-2/h1-2H3 |
| InChIKey | IEJIGPNLZYLLBP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. |
| Applications: | solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. reagent A substance used in a chemical reaction to detect, measure, examine, or produce other substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethyl carbonate (CHEBI:36596) has role reagent (CHEBI:33893) |
| dimethyl carbonate (CHEBI:36596) has role solvent (CHEBI:46787) |
| dimethyl carbonate (CHEBI:36596) is a carbonate ester (CHEBI:46722) |
| IUPAC Name |
|---|
| dimethyl carbonate |
| Synonyms | Source |
|---|---|
| methyl carbonate | ChemIDplus |
| carbonic acid, dimethyl ester | NIST Chemistry WebBook |
| DMC | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Dimethyl_carbonate | Wikipedia |
| HMDB0029580 | HMDB |
| Citations |
|---|