EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5NOS |
| Net Charge | 0 |
| Average Mass | 127.168 |
| Monoisotopic Mass | 127.00918 |
| SMILES | On1ccccc1=S |
| InChI | InChI=1S/C5H5NOS/c7-6-4-2-1-3-5(6)8/h1-4,7H |
| InChIKey | YBBJKCMMCRQZMA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | ionophore A compound which can carry specific ions through membranes of cells or organelles. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrithione (CHEBI:36578) has role ionophore (CHEBI:24869) |
| pyrithione (CHEBI:36578) is a monohydroxypyridine (CHEBI:38182) |
| pyrithione (CHEBI:36578) is a pyridinethione (CHEBI:38204) |
| pyrithione (CHEBI:36578) is tautomer of pyridine-2-thiol N-oxide (CHEBI:36584) |
| Incoming Relation(s) |
| pyridine-2-thiol N-oxide (CHEBI:36584) is tautomer of pyrithione (CHEBI:36578) |
| IUPAC Name |
|---|
| 1-hydroxypyridine-2(1H)-thione |
| Synonyms | Source |
|---|---|
| 1-hydroxy-2-pyridinethione | ChemIDplus |
| 1-hydroxyl-1H-pyridine-2-thione | ChemIDplus |
| 1-hydroxypyridine-2-thione | ChEBI |
| pyrithione | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:109936 | Reaxys |
| Gmelin:913415 | Gmelin |
| CAS:1121-30-8 | ChemIDplus |
| Citations |
|---|