EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O5 |
| Net Charge | 0 |
| Average Mass | 172.136 |
| Monoisotopic Mass | 172.03717 |
| SMILES | CC(=O)CC(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C7H8O5/c1-4(8)2-5(9)3-6(10)7(11)12/h2-3H2,1H3,(H,11,12) |
| InChIKey | VAKFRAZWNDUNDE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,6-trioxoheptanoic acid (CHEBI:36554) is a trioxo monocarboxylic acid (CHEBI:36553) |
| 2,4,6-trioxoheptanoic acid (CHEBI:36554) is conjugate acid of 2,4,6-trioxoheptanoate (CHEBI:19338) |
| Incoming Relation(s) |
| 2,4,6-trioxoheptanoate (CHEBI:19338) is conjugate base of 2,4,6-trioxoheptanoic acid (CHEBI:36554) |
| IUPAC Name |
|---|
| 2,4,6-trioxoheptanoic acid |