EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34 |
| Net Charge | 0 |
| Average Mass | 274.492 |
| Monoisotopic Mass | 274.26605 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@@]1(CC[C@]1([H])C(C)(C)CCC[C@@]21C)C[C@@H]3C |
| InChI | InChI=1S/C20H34/c1-14-12-20-11-8-16-18(2,3)9-5-10-19(16,4)17(20)7-6-15(14)13-20/h14-17H,5-13H2,1-4H3/t14-,15+,16+,17-,19+,20+/m0/s1 |
| InChIKey | IVZWRQBQDVHDNG-KUIXFMFUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-kaurane (CHEBI:36540) is a diterpene (CHEBI:35190) |
| ent-kaurane (CHEBI:36540) is enantiomer of kaurane (CHEBI:36539) |
| Incoming Relation(s) |
| ent-isokaurene (CHEBI:50783) has parent hydride ent-kaurane (CHEBI:36540) |
| ent-kaurane diterpenoid (CHEBI:36760) has parent hydride ent-kaurane (CHEBI:36540) |
| ent-kaurene (CHEBI:15415) has parent hydride ent-kaurane (CHEBI:36540) |
| kaurane (CHEBI:36539) is enantiomer of ent-kaurane (CHEBI:36540) |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2043842 | Beilstein |