EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11ClN2O4S |
| Net Charge | 0 |
| Average Mass | 338.772 |
| Monoisotopic Mass | 338.01281 |
| SMILES | NS(=O)(=O)c1cc(C2(O)NC(=O)c3ccccc32)ccc1Cl |
| InChI | InChI=1S/C14H11ClN2O4S/c15-11-6-5-8(7-12(11)22(16,20)21)14(19)10-4-2-1-3-9(10)13(18)17-14/h1-7,19H,(H,17,18)(H2,16,20,21) |
| InChIKey | JIVPVXMEBJLZRO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. renoprotective agent Any compound that is able to prevent damage to the kidneys. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorthalidone (CHEBI:3654) has role antiatherosclerotic agent (CHEBI:145947) |
| chlorthalidone (CHEBI:3654) has role antihypertensive agent (CHEBI:35674) |
| chlorthalidone (CHEBI:3654) has role cardiovascular drug (CHEBI:35554) |
| chlorthalidone (CHEBI:3654) has role hypoglycemic agent (CHEBI:35526) |
| chlorthalidone (CHEBI:3654) has role renoprotective agent (CHEBI:231911) |
| chlorthalidone (CHEBI:3654) is a isoindoles (CHEBI:24897) |
| chlorthalidone (CHEBI:3654) is a monochlorobenzenes (CHEBI:83403) |
| chlorthalidone (CHEBI:3654) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 2-chloro-5-(1-hydroxy-3-oxo-2,3-dihydro-1H-isoindol-1-yl)benzenesulfonamide |
| INN | Source |
|---|---|
| clortalidona | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-keto-3-(3'-sulfamyl-4'-chlorophenyl)-3-hydroxyisoindoline | ChemIDplus |
| 1-oxo-3-(3-sulfamyl-4-chlorophenyl)-3-hydroxyisoindoline | ChemIDplus |
| 2-chloro-5-(1-hydroxy-3-oxo-1-isoindolinyl)benzenesulfonamide | ChemIDplus |
| 2-chloro-5-(2,3-dihydro-1-hydroxy-3-oxo-1H-isoindol-1-yl)benzenesulfonamide | ChemIDplus |
| 3-(4'-chloro-3'-sulfamoylphenyl)-3-hydroxyphthalimidine | ChemIDplus |
| 3-hydroxy-3-(4-chloro-3-sulfamylphenyl)phthalimidine | ChemIDplus |
| Brand Names | Source |
|---|---|
| Chlorthalidone component of clorpres | ChEMBL |
| Chlorthalidone component of combipres | ChEMBL |
| Chlorthalidone component of demi-regroton | ChEMBL |
| Chlorthalidone component of edarbyclor | ChEMBL |
| Chlorthalidone component of kerledex | ChEMBL |
| Chlorthalidone component of lopressidone | ChEMBL |
| Citations |
|---|