EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12ClN5O4S |
| Net Charge | 0 |
| Average Mass | 357.779 |
| Monoisotopic Mass | 357.02985 |
| SMILES | COc1nc(C)nc(NC(=O)NS(=O)(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C12H12ClN5O4S/c1-7-14-10(17-12(15-7)22-2)16-11(19)18-23(20,21)9-6-4-3-5-8(9)13/h3-6H,1-2H3,(H2,14,15,16,17,18,19) |
| InChIKey | VJYIFXVZLXQVHO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorsulfuron (CHEBI:3652) has role agrochemical (CHEBI:33286) |
| chlorsulfuron (CHEBI:3652) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| chlorsulfuron (CHEBI:3652) has role herbicide (CHEBI:24527) |
| chlorsulfuron (CHEBI:3652) is a N-sulfonylurea (CHEBI:76983) |
| chlorsulfuron (CHEBI:3652) is a methoxy-1,3,5-triazine (CHEBI:38177) |
| chlorsulfuron (CHEBI:3652) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 2-chloro-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]benzenesulfonamide |
| Synonyms | Source |
|---|---|
| 2-chloro-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]benzene-1-sulfonamide | IUPAC |
| 1-(2-chlorophenylsulfonyl)-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea | ChEBI |
| DPX 4189 | PPDB |
| 2-chlorsulfuron | ChemIDplus |
| W 4189 | PPDB |
| 1-(2-chlorophenylsulphonyl)-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea | ChemIDplus |
| Brand Names | Source |
|---|---|
| Telar | ChemIDplus |
| Glean | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05071 | KEGG COMPOUND |
| 156 | PPDB |
| chlorsulfuron | Alan Wood's Pesticides |
| 1CS | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:577255 | Reaxys |
| CAS:64902-72-3 | ChemIDplus |
| CAS:64902-72-3 | NIST Chemistry WebBook |
| Citations |
|---|