EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C(C)[C@@H]1C/C=C(\C)CC/C=C(\C)CC1 |
| InChI | InChI=1S/C15H24/c1-12(2)15-10-8-13(3)6-5-7-14(4)9-11-15/h6,9,15H,1,5,7-8,10-11H2,2-4H3/b13-6+,14-9+/t15-/m0/s1 |
| InChIKey | XMRKUJJDDKYUHV-SDFJSLCBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-germacrene A (CHEBI:36515) is a germacrene A (CHEBI:36517) |
| (−)-germacrene A (CHEBI:36515) is enantiomer of (+)-germacrene A (CHEBI:41595) |
| Incoming Relation(s) |
| (+)-(1(10)E,4E,6S,7R)-germacradien-6-ol (CHEBI:137564) has parent hydride (−)-germacrene A (CHEBI:36515) |
| (+)-germacrene A (CHEBI:41595) is enantiomer of (−)-germacrene A (CHEBI:36515) |
| IUPAC Name |
|---|
| (1E,4E,7βH)-germacra-1(10),4,11(12)-triene |
| Synonyms | Source |
|---|---|
| (1E,5E,8S)-1,5-dimethyl-8-(1-methylethenyl)-1,5-cyclodecadiene | ChemIDplus |
| (1E,5E,8S)-8-isopropenyl-1,5-dimethylcyclodeca-1,5-diene | IUPAC |
| (−)-germacrene A | ChemIDplus |
| germacrene A | ChemIDplus |
| (E,E)-germacra-3,9,11-triene | NIST Chemistry WebBook |
| [S-(E,E)]-1,5-dimethyl-8-(1-methylethenyl)-1,5-cyclodecadiene | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2502353 | Beilstein |
| CAS:28387-44-2 | NIST Chemistry WebBook |
| CAS:28387-44-2 | ChemIDplus |