EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5O4 |
| Net Charge | -1 |
| Average Mass | 141.102 |
| Monoisotopic Mass | 141.01933 |
| SMILES | [H]C(=CC(=O)[O-])C=C([H])C(=O)O |
| InChI | InChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/p-1 |
| InChIKey | TXXHDPDFNKHHGW-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-carboxypenta-2,4-dienoate (CHEBI:36504) is a dicarboxylic acid monoanion (CHEBI:35695) |
| 5-carboxypenta-2,4-dienoate (CHEBI:36504) is conjugate acid of muconate (CHEBI:36157) |
| 5-carboxypenta-2,4-dienoate (CHEBI:36504) is conjugate base of muconic acid (CHEBI:38407) |
| Incoming Relation(s) |
| muconic acid (CHEBI:38407) is conjugate acid of 5-carboxypenta-2,4-dienoate (CHEBI:36504) |
| muconate (CHEBI:36157) is conjugate base of 5-carboxypenta-2,4-dienoate (CHEBI:36504) |