EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5O4 |
| Net Charge | -1 |
| Average Mass | 141.102 |
| Monoisotopic Mass | 141.01933 |
| SMILES | O=C([O-])/C=C\C=C/C(=O)O |
| InChI | InChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/p-1/b3-1-,4-2- |
| InChIKey | TXXHDPDFNKHHGW-CCAGOZQPSA-M |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z,4Z)-5-carboxypenta-2,4-dienoate (CHEBI:36501) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| (2Z,4Z)-5-carboxypenta-2,4-dienoate (CHEBI:36501) is a dicarboxylic acid monoanion (CHEBI:35695) |
| (2Z,4Z)-5-carboxypenta-2,4-dienoate (CHEBI:36501) is conjugate acid of cis,cis-muconate (CHEBI:32379) |
| (2Z,4Z)-5-carboxypenta-2,4-dienoate (CHEBI:36501) is conjugate base of cis,cis-muconic acid (CHEBI:16508) |
| Incoming Relation(s) |
| cis,cis-muconic acid (CHEBI:16508) is conjugate acid of (2Z,4Z)-5-carboxypenta-2,4-dienoate (CHEBI:36501) |
| cis,cis-muconate (CHEBI:32379) is conjugate base of (2Z,4Z)-5-carboxypenta-2,4-dienoate (CHEBI:36501) |