EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC(C)[C@@H]1CC[C@H](C)CC1=O |
| InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | NFLGAXVYCFJBMK-IUCAKERBSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-isomenthone (CHEBI:36496) is a isomenthone (CHEBI:36493) |
| (−)-isomenthone (CHEBI:36496) is enantiomer of (+)-isomenthone (CHEBI:36492) |
| Incoming Relation(s) |
| (+)-isomenthone (CHEBI:36492) is enantiomer of (−)-isomenthone (CHEBI:36496) |
| IUPAC Name |
|---|
| (2S,5S)-5-methyl-2-(propan-2-yl)cyclohexanone |
| Synonyms | Source |
|---|---|
| (1S,4S)-(−)-p-menthan-3-one | NIST Chemistry WebBook |
| (1S,4S)-p-menthan-3-one | IUPAC |
| (2S,5S)-2-isopropyl-5-methylcyclohexanone | IUPAC |
| (2S-cis)-5-methyl-2-(1-methylethyl)cyclohexanone | NIST Chemistry WebBook |
| (−)-isomenthone | NIST Chemistry WebBook |
| l-Isomenthone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17125 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2205779 | Beilstein |
| Gmelin:506095 | Gmelin |
| Beilstein:5245022 | Beilstein |
| CAS:18309-28-9 | NIST Chemistry WebBook |
| CAS:18309-28-9 | KEGG COMPOUND |