EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O |
| Net Charge | 0 |
| Average Mass | 428.745 |
| Monoisotopic Mass | 428.40182 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4([H])C(C)(C)CCC[C@]34C)[C@]1(C)CC[C@@]1([H])[C@@H](C(C)(C)O)CC[C@]21C |
| InChI | InChI=1S/C30H52O/c1-25(2)15-9-16-28(6)22(25)14-19-30(8)24(28)11-10-23-27(5)17-12-20(26(3,4)31)21(27)13-18-29(23,30)7/h20-24,31H,9-19H2,1-8H3/t20-,21-,22-,23+,24+,27-,28-,29+,30+/m0/s1 |
| InChIKey | PNJBOAVCVAVRGR-UDCAXGDQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lepisorus contortus (ncbitaxon:699669) | whole plant (BTO:0001461) | PubMed (21261296) | 95% EtOH extract of air-dried, powdered whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hopan-22-ol (CHEBI:36484) has role plant metabolite (CHEBI:76924) |
| hopan-22-ol (CHEBI:36484) is a hopanoid (CHEBI:51963) |
| hopan-22-ol (CHEBI:36484) is a pentacyclic triterpenoid (CHEBI:25872) |
| hopan-22-ol (CHEBI:36484) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| 2β-methylhopan-22-ol (CHEBI:132462) has functional parent hopan-22-ol (CHEBI:36484) |
| IUPAC Name |
|---|
| hopan-22-ol |
| Synonyms | Source |
|---|---|
| 22-Hopanol | KEGG COMPOUND |
| 22-hydroxyhopane | ChemIDplus |
| 29,29-dimethyl-21,30-dinorgammaceran-29-ol | IUPAC |
| A'-neogammaceran-22-ol | ChemIDplus |
| Diplopterol | KEGG COMPOUND |
| Hopan-22-ol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| hopan-22-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C06309 | KEGG COMPOUND |
| LMPR04000002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2566100 | Beilstein |
| CAS:1721-59-1 | KEGG COMPOUND |
| CAS:1721-59-1 | ChemIDplus |
| Citations |
|---|