EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O |
| Net Charge | 0 |
| Average Mass | 182.222 |
| Monoisotopic Mass | 182.07316 |
| SMILES | C1=CC2=Cc3ccccc3OC2C=C1 |
| InChI | InChI=1S/C13H10O/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9,12H |
| InChIKey | UKZBOPNPZRJVNI-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4aH-xanthene (CHEBI:36442) is a xanthene (CHEBI:36440) |
| 4aH-xanthene (CHEBI:36442) is tautomer of 3H-xanthene (CHEBI:36441) |
| 4aH-xanthene (CHEBI:36442) is tautomer of 9H-xanthene (CHEBI:10057) |
| Incoming Relation(s) |
| 3H-xanthene (CHEBI:36441) is tautomer of 4aH-xanthene (CHEBI:36442) |
| 9H-xanthene (CHEBI:10057) is tautomer of 4aH-xanthene (CHEBI:36442) |
| IUPAC Name |
|---|
| 4aH-xanthene |