EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28O2 |
| Net Charge | 0 |
| Average Mass | 276.420 |
| Monoisotopic Mass | 276.20893 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)CC[C@@]34[H])[C@@]1([H])CC[C@@H](O)C2 |
| InChI | InChI=1S/C18H28O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h11-16,19H,2-10H2,1H3/t11-,12+,13-,14+,15+,16-,18-/m0/s1 |
| InChIKey | UOUIARGWRPHDBX-CQZDKXCPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-norandrosterone (CHEBI:36412) has parent hydride estrane (CHEBI:23966) |
| 19-norandrosterone (CHEBI:36412) has role metabolite (CHEBI:25212) |
| 19-norandrosterone (CHEBI:36412) is a 17-oxo steroid (CHEBI:19168) |
| IUPAC Name |
|---|
| 3α-hydroxy-5α-estran-17-one |
| Synonyms | Source |
|---|---|
| 19-Noreoiandrosterone | ChemIDplus |
| 19-Noretiocholanolone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3207262 | Beilstein |
| CAS:65556-19-6 | ChemIDplus |