EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H24N6Ru |
| Net Charge | +2 |
| Average Mass | 641.700 |
| Monoisotopic Mass | 642.10950 |
| SMILES | C1=Cc2ccc3c4c2[N](=C1)[Ru+2]12([N]4=CC=C3)([N]3=CC=Cc4ccc5c(c43)[N]1=CC=C5)[N]1=CC=Cc3ccc4c(c31)[N]2=CC=C4 |
| InChI | InChI=1S/3C12H8N2.Ru/c3*1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h3*1-8H;/q;;;+2 |
| InChIKey | ASAYKRGNWRXMKP-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Λ-tris(1,10-phenanthroline)ruthenium(2+) (CHEBI:36411) is a tris(1,10-phenanthroline)ruthenium(2+) (CHEBI:36409) |
| Λ-tris(1,10-phenanthroline)ruthenium(2+) (CHEBI:36411) is enantiomer of Δ-tris(1,10-phenanthroline)ruthenium(2+) (CHEBI:36410) |
| Incoming Relation(s) |
| Δ-tris(1,10-phenanthroline)ruthenium(2+) (CHEBI:36410) is enantiomer of Λ-tris(1,10-phenanthroline)ruthenium(2+) (CHEBI:36411) |
| IUPAC Name |
|---|
| Λ-tris(1,10-phenanthroline-κ2N1,N10)ruthenium(2+) |
| Synonyms | Source |
|---|---|
| Λ-[Ru(phen)3]2+ | IUPAC |
| (+)-tris(1,10-phenanthroline)ruthenium(II) | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Gmelin:106395 | Gmelin |
| CAS:19368-51-5 | ChemIDplus |