EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3641 - chlorotrianisene
| Formula | C23H21ClO3 |
| Net Charge | 0 |
| Average Mass | 380.871 |
| Monoisotopic Mass | 380.11792 |
| SMILES | COc1ccc(C(Cl)=C(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H21ClO3/c1-25-19-10-4-16(5-11-19)22(17-6-12-20(26-2)13-7-17)23(24)18-8-14-21(27-3)15-9-18/h4-15H,1-3H3 |
| InChIKey | BFPSDSIWYFKGBC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. estrogen receptor modulator A substance that possess antiestrogenic actions but can also produce estrogenic effects as well. It acts as complete or partial agonist or as antagonist. It can be either steroidal or nonsteroidal in structure. xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorotrianisene (CHEBI:3641) has parent hydride stilbene (CHEBI:26775) |
| chlorotrianisene (CHEBI:3641) has role antineoplastic agent (CHEBI:35610) |
| chlorotrianisene (CHEBI:3641) has role estrogen receptor modulator (CHEBI:50739) |
| chlorotrianisene (CHEBI:3641) has role xenoestrogen (CHEBI:76988) |
| chlorotrianisene (CHEBI:3641) is a chloroalkene (CHEBI:36387) |
| IUPAC Name |
|---|
| 1,1',1''-(2-chloroethene-1,1,2-triyl)tris(4-methoxybenzene) |
| INNs | Source |
|---|---|
| chlorotrianisene | ChEBI |
| chlorotrianisène | ChEBI |
| clorotrianiseno | ChEBI |
| chlorotrianisenum | ChEBI |
| Synonyms | Source |
|---|---|
| Chloortrianisestrol | DrugBank |
| Chlorestrolo | DrugBank |
| Chlorotrianisine | DrugBank |
| Chlorotrianizen | DrugBank |
| Chlortrianisen | DrugBank |
| Chlortrianisestrol | DrugBank |