EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:36408 - 5-hydroxy-L-kynurenine
| Formula | C10H12N2O4 |
| Net Charge | 0 |
| Average Mass | 224.216 |
| Monoisotopic Mass | 224.07971 |
| SMILES | Nc1ccc(O)cc1C(=O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H12N2O4/c11-7-2-1-5(13)3-6(7)9(14)4-8(12)10(15)16/h1-3,8,13H,4,11-12H2,(H,15,16)/t8-/m0/s1 |
| InChIKey | OTDQYOVYQQZAJL-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxy-L-kynurenine (CHEBI:36408) is a 5-hydroxykynurenine (CHEBI:2076) |
| 5-hydroxy-L-kynurenine (CHEBI:36408) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 5-hydroxy-L-kynurenine (CHEBI:36408) is tautomer of 5-hydroxy-L-kynurenine zwitterion (CHEBI:62624) |
| Incoming Relation(s) |
| 5-hydroxy-N-formyl-L-kynurenine (CHEBI:36407) has functional parent 5-hydroxy-L-kynurenine (CHEBI:36408) |
| 5-hydroxy-L-kynurenine zwitterion (CHEBI:62624) is tautomer of 5-hydroxy-L-kynurenine (CHEBI:36408) |
| IUPAC Name |
|---|
| 3-(2-amino-5-hydroxybenzoyl)-L-alanine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-4-(2-amino-5-hydroxyphenyl)-4-oxobutanoic acid | IUPAC |
| 5-Hydroxy-L-kynurenine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05651 | KEGG COMPOUND |