EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO4S |
| Net Charge | 0 |
| Average Mass | 191.208 |
| Monoisotopic Mass | 191.02523 |
| SMILES | O=C(O)[C@@H]1CSC[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C6H9NO4S/c8-5(9)3-1-12-2-4(7-3)6(10)11/h3-4,7H,1-2H2,(H,8,9)(H,10,11)/t3-,4-/m0/s1 |
| InChIKey | MHRLWUPLSHYLOK-IMJSIDKUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,5R)-thiomorpholine-3,5-dicarboxylic acid (CHEBI:36400) is a thiomorpholine-3,5-dicarboxylic acid (CHEBI:36397) |
| (3R,5R)-thiomorpholine-3,5-dicarboxylic acid (CHEBI:36400) is enantiomer of (3S,5S)-thiomorpholine-3,5-dicarboxylic acid (CHEBI:36399) |
| Incoming Relation(s) |
| (3S,5S)-thiomorpholine-3,5-dicarboxylic acid (CHEBI:36399) is enantiomer of (3R,5R)-thiomorpholine-3,5-dicarboxylic acid (CHEBI:36400) |
| IUPAC Name |
|---|
| (3R,5R)-thiomorpholine-3,5-dicarboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4294091 | Beilstein |