EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8Cl4N2 |
| Net Charge | 0 |
| Average Mass | 265.914 |
| Monoisotopic Mass | 263.88156 |
| SMILES | N#Cc1c(Cl)c(Cl)c(Cl)c(C#N)c1Cl |
| InChI | InChI=1S/C8Cl4N2/c9-5-3(1-13)6(10)8(12)7(11)4(5)2-14 |
| InChIKey | CRQQGFGUEAVUIL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorothalonil (CHEBI:3639) has functional parent isophthalonitrile (CHEBI:38218) |
| chlorothalonil (CHEBI:3639) has role antifungal agrochemical (CHEBI:86328) |
| chlorothalonil (CHEBI:3639) is a aromatic fungicide (CHEBI:87034) |
| chlorothalonil (CHEBI:3639) is a dinitrile (CHEBI:51308) |
| chlorothalonil (CHEBI:3639) is a tetrachlorobenzene (CHEBI:26888) |
| IUPAC Name |
|---|
| 2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile |
| Synonyms | Source |
|---|---|
| Chlorothalonil | KEGG COMPOUND |
| Tetrachloroisophthalonitrile | KEGG COMPOUND |
| 1,3-Dicyanotetrachlorobenzene | ChemIDplus |
| 2,4,5,6-Tetrachloro-3-cyanobenzonitrile | ChemIDplus |
| m-TCPN | ChemIDplus |
| m-Tetrachlorophthalonitrile | ChemIDplus |
| Brand Name | Source |
|---|---|
| Daconil | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| chlorothalonil | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C11037 | KEGG COMPOUND |
| Chlorothalonil | Wikipedia |
| chlorothalonil | Alan Wood's Pesticides |
| US3290353 | Patent |
| US3652637 | Patent |
| 150 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1978326 | Reaxys |
| CAS:1897-45-6 | KEGG COMPOUND |
| CAS:1897-45-6 | NIST Chemistry WebBook |
| Citations |
|---|