EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O |
| Net Charge | 0 |
| Average Mass | 320.436 |
| Monoisotopic Mass | 320.18886 |
| SMILES | [H][C@@]12N3CC[C@]4([H])OCC=C5CN6CC[C@@]1(c1ccccc13)[C@]6([H])C[C@]5([H])[C@]24[H] |
| InChI | InChI=1S/C21H24N2O/c1-2-4-16-15(3-1)21-7-9-22-12-13-6-10-24-17-5-8-23(16)20(21)19(17)14(13)11-18(21)22/h1-4,6,14,17-20H,5,7-12H2/t14-,17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | AGRTUYYPROFOFX-ZMUQRAOQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strychnidine (CHEBI:36337) is a indole alkaloid fundamental parent (CHEBI:38482) |
| strychnidine (CHEBI:36337) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| strychnidine (CHEBI:36337) is a organic heteroheptacyclic compound (CHEBI:52157) |
| strychnidine (CHEBI:36337) is a quinoline alkaloid (CHEBI:26509) |
| strychnidine (CHEBI:36337) is a quinoline alkaloid fundamental parent (CHEBI:38514) |
| Incoming Relation(s) |
| strychnine (CHEBI:28973) has parent hydride strychnidine (CHEBI:36337) |
| IUPAC Name |
|---|
| strychnidine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:44534 | Beilstein |