EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H7O2 |
| Net Charge | -1 |
| Average Mass | 171.175 |
| Monoisotopic Mass | 171.04515 |
| SMILES | O=C([O-])c1cccc2ccccc12 |
| InChI | InChI=1S/C11H8O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H,12,13)/p-1 |
| InChIKey | LNETULKMXZVUST-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | fungal xenobiotic metabolite Any fungal metabolite produced by metabolism of a xenobiotic compound in fungi. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-naphthoate (CHEBI:36298) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 1-naphthoate (CHEBI:36298) has role fungal xenobiotic metabolite (CHEBI:76968) |
| 1-naphthoate (CHEBI:36298) is a naphthoate (CHEBI:25482) |
| 1-naphthoate (CHEBI:36298) is conjugate base of 1-naphthoic acid (CHEBI:36466) |
| Incoming Relation(s) |
| 1-naphthoic acid (CHEBI:36466) is conjugate acid of 1-naphthoate (CHEBI:36298) |
| IUPAC Name |
|---|
| naphthalene-1-carboxylate |
| Synonym | Source |
|---|---|
| 1-naphthoate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 1-naphthoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-7615 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:332225 | Gmelin |
| Beilstein:3905477 | Beilstein |
| Reaxys:3905477 | Reaxys |