EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3O6Te |
| Net Charge | -3 |
| Average Mass | 226.618 |
| Monoisotopic Mass | 228.90083 |
| SMILES | [H]O[Te]([O-])([O-])([O-])(O[H])O[H] |
| InChI | InChI=1S/H6O6Te/c1-7(2,3,4,5)6/h1-6H/p-3 |
| InChIKey | FXADMRZICBQPQY-UHFFFAOYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orthotellurate(3−) (CHEBI:36291) is a orthotellurate ion (CHEBI:36289) |
| orthotellurate(3−) (CHEBI:36291) is conjugate acid of orthotellurate(4−) (CHEBI:36290) |
| orthotellurate(3−) (CHEBI:36291) is conjugate base of orthotellurate(2−) (CHEBI:36292) |
| Incoming Relation(s) |
| orthotellurate(2−) (CHEBI:36292) is conjugate acid of orthotellurate(3−) (CHEBI:36291) |
| orthotellurate(4−) (CHEBI:36290) is conjugate base of orthotellurate(3−) (CHEBI:36291) |
| IUPAC Names |
|---|
| trihydrogen orthotellurate |
| trihydroxidotrioxidotellurate(3−) |
| Synonyms | Source |
|---|---|
| H3TeO63− | IUPAC |
| [TeO3(OH)3]3− | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:324850 | Gmelin |