EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35N3 |
| Net Charge | 0 |
| Average Mass | 317.521 |
| Monoisotopic Mass | 317.28310 |
| SMILES | [H][C@@]12CCCN[C@@]1([H])[C@@]1([C@@]3([H])CCCCN3)CN3CCCC[C@]3([H])[C@@]([H])(C2)C1 |
| InChI | InChI=1S/C20H35N3/c1-3-9-21-18(8-1)20-13-16(12-15-6-5-10-22-19(15)20)17-7-2-4-11-23(17)14-20/h15-19,21-22H,1-14H2/t15-,16-,17+,18+,19+,20+/m0/s1 |
| InChIKey | YUKCLPPRYNXRAF-VTYCOLDWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ormosanine (CHEBI:36286) is a quinolizidine alkaloid (CHEBI:26515) |
| ormosanine (CHEBI:36286) is a quinolizidine alkaloid fundamental parent (CHEBI:38526) |
| IUPAC Name |
|---|
| ormosanine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6892989 | Beilstein |