EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27NO |
| Net Charge | 0 |
| Average Mass | 345.486 |
| Monoisotopic Mass | 345.20926 |
| SMILES | [H][C@]12C[C@]3([H])CCCCN3[C@@]([H])(C1)c1ccccc1-c1cccc(c1)/C=C\CO2 |
| InChI | InChI=1S/C24H27NO/c1-2-12-23-22(11-1)19-9-5-7-18(15-19)8-6-14-26-21-16-20-10-3-4-13-25(20)24(23)17-21/h1-2,5-9,11-12,15,20-21,24H,3-4,10,13-14,16-17H2/b8-6-/t20-,21-,24-/m0/s1 |
| InChIKey | MTRZJAQTFNGSJM-BDFAEJNJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lythran (CHEBI:36283) is a quinolizidine alkaloid (CHEBI:26515) |
| lythran (CHEBI:36283) is a quinolizidine alkaloid fundamental parent (CHEBI:38526) |
| IUPAC Name |
|---|
| lythran |