EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8Cl2O2 |
| Net Charge | 0 |
| Average Mass | 207.056 |
| Monoisotopic Mass | 205.99013 |
| SMILES | COc1cc(Cl)c(OC)cc1Cl |
| InChI | InChI=1S/C8H8Cl2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
| InChIKey | PFIADAMVCJPXSF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloroneb (CHEBI:3628) has role antifungal agrochemical (CHEBI:86328) |
| chloroneb (CHEBI:3628) is a aromatic fungicide (CHEBI:87034) |
| chloroneb (CHEBI:3628) is a dichlorobenzene (CHEBI:23697) |
| chloroneb (CHEBI:3628) is a dimethoxybenzene (CHEBI:51681) |
| IUPAC Name |
|---|
| 1,4-dichloro-2,5-dimethoxybenzene |
| Synonyms | Source |
|---|---|
| chloronèbe | ChemIDplus |
| 2,5-dichloro-1,4-dimethoxybenzene | ChEBI |
| Brand Names | Source |
|---|---|
| Demosan | ChemIDplus |
| Demasan | ChemIDplus |
| Terraneb | ChemIDplus |
| Citations |
|---|