EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H47N3O10S |
| Net Charge | 0 |
| Average Mass | 641.784 |
| Monoisotopic Mass | 641.29822 |
| SMILES | CCCCC[C@H](O)/C=C/C=C\C=C\C=C\[C@@H](SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C30H47N3O10S/c1-2-3-8-12-21(34)13-9-6-4-5-7-10-15-25(24(35)14-11-16-27(37)38)44-20-23(29(41)32-19-28(39)40)33-26(36)18-17-22(31)30(42)43/h4-7,9-10,13,15,21-25,34-35H,2-3,8,11-12,14,16-20,31H2,1H3,(H,32,41)(H,33,36)(H,37,38)(H,39,40)(H,42,43)/b6-4-,7-5+,13-9+,15-10+/t21-,22-,23-,24-,25+/m0/s1 |
| InChIKey | CYCIJLWHNZKKBC-MTFYIJSJSA-N |
| Roles Classification |
|---|
| Biological Role: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Application: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lipoxin C4 (CHEBI:36220) is a lipoxin (CHEBI:6497) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-{(1R,2E,4E,6Z,8E,10S)-1-[(1S)-4-carboxy-1-hydroxybutyl]-10-hydroxypentadeca-2,4,6,8-tetraen-1-yl}-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| 15-Hydroxy-delta-13-leukotriene C3 | ChemIDplus |
| 15(S)-hydroxy-Δ13-trans-leukotriene C3 | ChEBI |
| 15-OH-Ltc3 | ChemIDplus |
| 5,15-Dihydroxy-6-S-glutathionyl-7,9,13,11-eicosatetraenoic acid | ChemIDplus |
| Glycine, N-(S-(1-(4-carboxy-1-hydroxybutyl)-10-hydroxy-2,4,6,8-pentadecatetraenyl)-N-L-gamma-glutamyl-L-cysteinyl)-, (1R-(1R*,1(S*),2E,4E,6Z,8E,10S*))- | ChemIDplus |
| LXC4 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:85951-62-8 | ChemIDplus |