EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O5 |
| Net Charge | 0 |
| Average Mass | 354.487 |
| Monoisotopic Mass | 354.24062 |
| SMILES | CCCCC/C=C\C[C@H](O)[C@H](O)/C=C/C(O)C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H34O5/c1-2-3-4-5-6-10-13-18(22)19(23)16-15-17(21)12-9-7-8-11-14-20(24)25/h6-7,9-10,15-19,21-23H,2-5,8,11-14H2,1H3,(H,24,25)/b9-7-,10-6-,16-15+/t17?,18-,19+/m0/s1 |
| InChIKey | WPLPEZUSILBTGP-CIQDQOFUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trioxilin A3 (CHEBI:36203) has functional parent (5Z,9E,14Z)-icosa-5,9,14-trienoic acid (CHEBI:36037) |
| trioxilin A3 (CHEBI:36203) is a trioxilin (CHEBI:36201) |
| trioxilin A3 (CHEBI:36203) is conjugate acid of trioxilin A3(1−) (CHEBI:78100) |
| Incoming Relation(s) |
| trioxilin A3(1−) (CHEBI:78100) is conjugate base of trioxilin A3 (CHEBI:36203) |
| IUPAC Name |
|---|
| (5Z,9E,11R,12S,14Z)-8,11,12-trihydroxyicosa-5,9,14-trienoic acid |
| Synonyms | Source |
|---|---|
| (5Z,9E,14Z)-(11R,12S)-8,11,12-Trihydroxyeicosa-5,9,14-trienoic acid | KEGG COMPOUND |
| (5Z,9E,14Z)-(11R,12S)-8,11,12-Trihydroxyicosa-5,9,14-trienoic acid | KEGG COMPOUND |
| 8,11,12-Teta | ChemIDplus |
| (8,11R,12S)-OH 5c9t14t-20:3 | ChEBI |
| (8,11R,12S)-OH 5c9t14t-C20:3 | ChEBI |
| 8,11R,12S-triOH 5c9t14c-20:3 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14809 | KEGG COMPOUND |
| LMFA03090002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:68860-46-8 | ChemIDplus |
| Citations |
|---|