EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45NO |
| Net Charge | 0 |
| Average Mass | 399.663 |
| Monoisotopic Mass | 399.35012 |
| SMILES | [H][C@@]12CCC3CCCC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@@]3(CC[C@H](C)CN3)[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C27H45NO/c1-17-10-14-27(28-16-17)18(2)24-23(29-27)15-22-20-9-8-19-7-5-6-12-25(19,3)21(20)11-13-26(22,24)4/h17-24,28H,5-16H2,1-4H3/t17-,18-,19?,20+,21-,22-,23-,24-,25-,26-,27-/m0/s1 |
| InChIKey | KOZCINYDCJVLDW-LWXZRZDISA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tomatidane (CHEBI:36196) is a spirosolane (CHEBI:36189) |
| Incoming Relation(s) |
| tomatidine (CHEBI:9629) has parent hydride tomatidane (CHEBI:36196) |
| IUPAC Name |
|---|
| (22S,25S)-spirosolane |
| Synonym | Source |
|---|---|
| (22S,25S)-tomatanine | IUBMB |