EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | [H][C@@]1(/C=C/C(O)C/C=C\CCCC(=O)O)O[C@@]1([H])C/C=C\CCCCC |
| InChI | InChI=1S/C20H32O4/c1-2-3-4-5-6-10-13-18-19(24-18)16-15-17(21)12-9-7-8-11-14-20(22)23/h6-7,9-10,15-19,21H,2-5,8,11-14H2,1H3,(H,22,23)/b9-7-,10-6-,16-15+/t17?,18-,19-/m0/s1 |
| InChIKey | SGTUOBURCVMACZ-SEVPPISGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (8573089) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (15123652) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hepoxilin A3 (CHEBI:36190) has functional parent (5Z,9E,14Z)-icosa-5,9,14-trienoic acid (CHEBI:36037) |
| hepoxilin A3 (CHEBI:36190) has role human xenobiotic metabolite (CHEBI:76967) |
| hepoxilin A3 (CHEBI:36190) has role rat metabolite (CHEBI:86264) |
| hepoxilin A3 (CHEBI:36190) is a epoxy fatty acid (CHEBI:61498) |
| hepoxilin A3 (CHEBI:36190) is a hepoxilin (CHEBI:36200) |
| hepoxilin A3 (CHEBI:36190) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| hepoxilin A3 (CHEBI:36190) is a long-chain fatty acid (CHEBI:15904) |
| hepoxilin A3 (CHEBI:36190) is conjugate acid of hepoxilin A3(1−) (CHEBI:132127) |
| Incoming Relation(s) |
| (8S)-hepoxilin A3 (CHEBI:132809) is a hepoxilin A3 (CHEBI:36190) |
| hepoxilin A3(1−) (CHEBI:132127) is conjugate base of hepoxilin A3 (CHEBI:36190) |
| IUPAC Name |
|---|
| (5Z,9E)-8-hydroxy-10-{(2S,3S)-3-[(2Z)-oct-2-en-1-yl]oxiran-2-yl}deca-5,9-dienoic acid |
| Synonyms | Source |
|---|---|
| (5Z,9E,14Z)-(11S,12S)-11,12-Epoxy-8-hydroxyeicosa-5,9,14-trienoic acid | KEGG COMPOUND |
| (5Z,9E,14Z)-(11S,12S)-11,12-Epoxy-8-hydroxyicosa-5,9,14-trienoic acid | KEGG COMPOUND |
| 8-EH-2 | ChemIDplus |
| 8-hydroxy-10-(3-(2-octenyl)oxiranyl)-5,9-decadienoic acid | ChemIDplus |
| 8-Hydroxy-11,12-epoxyeicosa-5,9,14-trienoic acid | ChemIDplus |
| 8-hydroxy-11(S),12(S)-epoxy-eicosa- 5Z,9E,14Z-trienoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14808 | KEGG COMPOUND |
| LMFA03090005 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21024403 | Reaxys |
| CAS:85589-24-8 | ChemIDplus |
| CAS:94161-11-2 | ChemIDplus |
| Citations |
|---|