EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H56FeN4O6 |
| Net Charge | +1 |
| Average Mass | 852.854 |
| Monoisotopic Mass | 852.35437 |
| SMILES | [H]C(=O)C1=C(CCC(=O)O)C2=[N]3C1=Cc1c(C)c([C@@H](O)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)c4[n]1[Fe+]31[N]3=C(C=c5c(C)c(CCC(=O)O)c([n]51)=C2)C(C=C)=C(C)C3=C4 |
| InChI | InChI=1S/C49H58N4O6.Fe/c1-9-34-31(6)39-25-45-49(46(55)18-12-17-30(5)16-11-15-29(4)14-10-13-28(2)3)33(8)40(52-45)24-44-37(27-54)36(20-22-48(58)59)43(53-44)26-42-35(19-21-47(56)57)32(7)38(51-42)23-41(34)50-39;/h9,13,15,17,23-27,46,55H,1,10-12,14,16,18-22H2,2-8H3,(H4,50,51,52,53,54,56,57,58,59);/q;+3/p-2/b29-15+,30-17+,38-23-,39-25-,40-24-,41-23-,42-26-,43-26-,44-24-,45-25-;/t46-;/m0./s1 |
| InChIKey | HIXFOFPPNIASLP-PRYGPKJJSA-L |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferriheme a (CHEBI:36183) has role cofactor (CHEBI:23357) |
| ferriheme a (CHEBI:36183) is a ferriheme (CHEBI:38574) |
| ferriheme a (CHEBI:36183) is a heme a (CHEBI:24479) |
| ferriheme a (CHEBI:36183) is conjugate acid of ferriheme a(1−) (CHEBI:60532) |
| Incoming Relation(s) |
| ferriheme a(1−) (CHEBI:60532) is conjugate base of ferriheme a (CHEBI:36183) |
| IUPAC Name |
|---|
| [3,3'-{7-ethenyl-17-formyl-12-[(1S,4E,8E)-1-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trien-1-yl]-3,8,13-trimethylporphyrin-2,18-diyl-κ4N21,N22,N23,N24}di(propanoato)(2−)]iron(1+) |
| Synonyms | Source |
|---|---|
| (cytoporphyrinato)iron(1+) | ChEBI |
| (cytoporphyrinato)iron(III) | ChEBI |
| HEME-AS | PDBeChem |
| (S)-ferriheme a | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HAS | PDBeChem |
| Citations |
|---|