EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N2O4Pt |
| Net Charge | 0 |
| Average Mass | 437.353 |
| Monoisotopic Mass | 437.09145 |
| SMILES | [H][C@]12CCC[N]1([H])[Pt]1([O]C(=O)C3(CCC3)C(=O)[O]1)[N]([H])([H])C2 |
| InChI | InChI=1S/C6H8O4.C5H12N2.Pt/c7-4(8)6(5(9)10)2-1-3-6;6-4-5-2-1-3-7-5;/h1-3H2,(H,7,8)(H,9,10);5,7H,1-4,6H2;/q;;+2/p-2/t;5-;/m.1./s1 |
| InChIKey | XXUHLUDUCZQMDI-UTYJZAQGSA-L |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| miboplatin (CHEBI:36143) has role antineoplastic agent (CHEBI:35610) |
| miboplatin (CHEBI:36143) is a platinum coordination entity (CHEBI:33862) |
| miboplatin (CHEBI:36143) is a pyrrolidines (CHEBI:38260) |
| IUPAC Name |
|---|
| (SP-4-3)-[cyclobutane-1,1-dicarboxylato(2−)-κ2O,O']{1-[(2R)-pyrrolidin-2-yl-κN]methanamine-κN}platinum |
| Synonym | Source |
|---|---|
| miboplatin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Gmelin:488680 | Gmelin |
| CAS:103775-75-3 | ChemIDplus |