EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClO7 |
| Net Charge | 0 |
| Average Mass | 378.764 |
| Monoisotopic Mass | 378.05063 |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3cccc(Cl)c3O)oc2c1OC |
| InChI | InChI=1S/C18H15ClO7/c1-23-11-7-10(20)12-14(22)18(25-3)15(26-17(12)16(11)24-2)8-5-4-6-9(19)13(8)21/h4-7,20-21H,1-3H3 |
| InChIKey | JLSQXYITDXJTKL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus candidus (ncbitaxon:41067) | - | PubMed (5391291) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorflavonin (CHEBI:3613) has role Aspergillus metabolite (CHEBI:76956) |
| chlorflavonin (CHEBI:3613) has role antifungal agent (CHEBI:35718) |
| chlorflavonin (CHEBI:3613) is a dihydroxyflavone (CHEBI:38686) |
| chlorflavonin (CHEBI:3613) is a monochlorobenzenes (CHEBI:83403) |
| chlorflavonin (CHEBI:3613) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 2-(3-chloro-2-hydroxyphenyl)-5-hydroxy-3,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| 3'-chloro-2',5-dihydroxy-3,7,8-trimethoxyflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00001026 | KNApSAcK |
| C10027 | KEGG COMPOUND |
| LMPK12113075 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1300439 | Reaxys |
| CAS:23363-64-6 | KEGG COMPOUND |
| CAS:23363-64-6 | ChemIDplus |
| Citations |
|---|