EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O |
| Net Charge | 0 |
| Average Mass | 132.162 |
| Monoisotopic Mass | 132.05751 |
| SMILES | C1=Cc2ccccc2CO1 |
| InChI | InChI=1S/C9H8O/c1-2-4-9-7-10-6-5-8(9)3-1/h1-6H,7H2 |
| InChIKey | MFJCPDOGFAYSTF-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1H-isochromene (CHEBI:36115) is a isochromene (CHEBI:36117) |
| 1H-isochromene (CHEBI:36115) is tautomer of 3H-isochromene (CHEBI:36116) |
| Incoming Relation(s) |
| isochromenylium (CHEBI:36119) has parent hydride 1H-isochromene (CHEBI:36115) |
| isocoumarin (CHEBI:38759) has parent hydride 1H-isochromene (CHEBI:36115) |
| 3H-isochromene (CHEBI:36116) is tautomer of 1H-isochromene (CHEBI:36115) |
| IUPAC Name |
|---|
| 1H-isochromene |
| Registry Numbers | Sources |
|---|---|
| Beilstein:109937 | Beilstein |