EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO5 |
| Net Charge | 0 |
| Average Mass | 211.173 |
| Monoisotopic Mass | 211.04807 |
| SMILES | NC(CC1=CC(=O)C(O)=CC1=O)C(=O)O |
| InChI | InChI=1S/C9H9NO5/c10-5(9(14)15)1-4-2-7(12)8(13)3-6(4)11/h2-3,5,13H,1,10H2,(H,14,15) |
| InChIKey | AGMJSPIGDFKRRO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| topaquinone (CHEBI:36077) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| topaquinone (CHEBI:36077) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| topaquinone (CHEBI:36077) is tautomer of topaquinone zwitterion (CHEBI:68431) |
| Incoming Relation(s) |
| L-topaquinone (CHEBI:36076) is a topaquinone (CHEBI:36077) |
| topaquinone zwitterion (CHEBI:68431) is tautomer of topaquinone (CHEBI:36077) |
| IUPAC Name |
|---|
| 2-amino-3-(4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-yl)propanoic acid |
| Synonym | Source |
|---|---|
| 2,4,5-trihydroxyphenylalanine quinone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2850806 | Reaxys |