EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3606 - Chloramphenicol succinate
| Formula | C15H16Cl2N2O8 |
| Net Charge | 0 |
| Average Mass | 423.205 |
| Monoisotopic Mass | 422.02837 |
| SMILES | [H][C@](COC(=O)CCC(=O)O)(NC(=O)C(Cl)Cl)[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H16Cl2N2O8/c16-14(17)15(24)18-10(7-27-12(22)6-5-11(20)21)13(23)8-1-3-9(4-2-8)19(25)26/h1-4,10,13-14,23H,5-7H2,(H,18,24)(H,20,21)/t10-,13-/m1/s1 |
| InChIKey | LIRCDOVJWUGTMW-ZWNOBZJWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chloramphenicol succinate (CHEBI:3606) is a amphetamines (CHEBI:35338) |
| Chloramphenicol succinate (CHEBI:3606) is a hemisuccinate (CHEBI:138979) |
| Synonyms | Source |
|---|---|
| chloramphenicol monosuccinate sodium salt | DrugCentral |
| chloramphenicol sodium succinate | DrugCentral |
| Chloramphenicol succinate | KEGG COMPOUND |
| chloramphenicol succinate sodium | DrugCentral |
| levomycetin sodium succinate | DrugCentral |
| sodium chloramphenicol succinate | DrugCentral |