EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H37N |
| Net Charge | 0 |
| Average Mass | 315.545 |
| Monoisotopic Mass | 315.29260 |
| SMILES | [H][C@@]12CCC[C@@]13CC[C@@H]1CN3[C@@]3([H])[C@@H](C(C)C)CC[C@]1(C)[C@]23CCC |
| InChI | InChI=1S/C22H37N/c1-5-10-22-18-7-6-11-21(18)13-8-16-14-23(21)19(22)17(15(2)3)9-12-20(16,22)4/h15-19H,5-14H2,1-4H3/t16-,17-,18-,19+,20+,21-,22-/m1/s1 |
| InChIKey | CGPFADLKIPZYRE-OWLUANBVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daphnane (CHEBI:36058) is a diterpene alkaloid (CHEBI:23847) |
| daphnane (CHEBI:36058) is a terpene alkaloid fundamental parent (CHEBI:38525) |
| Incoming Relation(s) |
| daphnetoxin (CHEBI:4321) has functional parent daphnane (CHEBI:36058) |
| IUPAC Name |
|---|
| daphnane |