EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H]C(=CCCCCCC)C=C([H])CC=C([H])CC=C([H])CCCC(=O)O |
| InChI | InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h7-10,12-13,15-16H,2-6,11,14,17-19H2,1H3,(H,21,22) |
| InChIKey | IJAXPCZCTKDWBJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icosa-5,8,11,13-tetraenoic acid (CHEBI:36035) is a icosatetraenoic acid (CHEBI:36033) |
| Incoming Relation(s) |
| (5Z,8Z,11Z,13E)-15-HETE (CHEBI:64017) has functional parent icosa-5,8,11,13-tetraenoic acid (CHEBI:36035) |
| 15-oxo-ETE (CHEBI:15559) has functional parent icosa-5,8,11,13-tetraenoic acid (CHEBI:36035) |
| 15(S)-HPETE (CHEBI:15628) has functional parent icosa-5,8,11,13-tetraenoic acid (CHEBI:36035) |
| IUPAC Name |
|---|
| icosa-5,8,11,13-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 20:4, n-7,9,12,15 | ChEBI |
| 5,8,11,13-eicosatetraenoic acid | ChEBI |
| 5,8,11,13-eicosatetraenoic acids | ChEBI |
| 5,8,11,13-icosatetraenoic acid | ChEBI |
| 5,8,11,13-icosatetraenoic acids | ChEBI |
| C20:4, n-7,9,12,15 | ChEBI |