EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO |
| Net Charge | 0 |
| Average Mass | 151.209 |
| Monoisotopic Mass | 151.09971 |
| SMILES | C[C@@H](N)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9-/m1/s1 |
| InChIKey | DLNKOYKMWOXYQA-VXNVDRBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-norephedrine (CHEBI:36) is a amphetamines (CHEBI:35338) |
| (+)-norephedrine (CHEBI:36) is a phenethylamine alkaloid (CHEBI:38605) |
| IUPAC Name |
|---|
| (1S,2R)-2-amino-1-phenylpropan-1-ol |
| Synonyms | Source |
|---|---|
| (+)-norephedrin | ChemIDplus |
| d-norephedrine | ChemIDplus |
| (+)-(1S,2R)-norephedrine | ChEBI |
| d-phenylpropanolamine | ChemIDplus |
| (1S,2R)-2-amino-1-phenyl-1-propanol | ChEBI |
| erythro-α-(1-aminoethyl)benzyl alcohol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2802896 | Reaxys |
| CAS:37577-28-9 | ChemIDplus |
| CAS:37577-28-9 | NIST Chemistry WebBook |
| Citations |
|---|