EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NOS |
| Net Charge | 0 |
| Average Mass | 143.211 |
| Monoisotopic Mass | 143.04048 |
| SMILES | [H][C@@]12CC(=O)N1CCCS2 |
| InChI | InChI=1S/C6H9NOS/c8-5-4-6-7(5)2-1-3-9-6/h6H,1-4H2/t6-/m1/s1 |
| InChIKey | QHTOIDKCEPKVCM-ZCFIWIBFSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cepham (CHEBI:35993) is a cephams (CHEBI:35995) |
| cepham (CHEBI:35993) is a natural product fundamental parent (CHEBI:35507) |
| cepham (CHEBI:35993) is a saturated organic heterobicyclic parent (CHEBI:38419) |
| IUPAC Name |
|---|
| cepham |
| Synonym | Source |
|---|---|
| (6R)-5-thia-1-azabicyclo[4.2.0]octan-8-one | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13265235 | Reaxys |