EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N2 |
| Net Charge | 0 |
| Average Mass | 282.431 |
| Monoisotopic Mass | 282.20960 |
| SMILES | [H][C@@]12C[C@@H]3N(CC[C@@]34c3ccccc3N[C@H]4[C@@H]1C)C[C@H]2CC |
| InChI | InChI=1S/C19H26N2/c1-3-13-11-21-9-8-19-15-6-4-5-7-16(15)20-18(19)12(2)14(13)10-17(19)21/h4-7,12-14,17-18,20H,3,8-11H2,1-2H3/t12-,13-,14-,17+,18+,19-/m1/s1 |
| InChIKey | KNZUAMRYQXIWSR-RUAUHYFQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| curan (CHEBI:35948) is a indole alkaloid (CHEBI:38958) |
| curan (CHEBI:35948) is a indole alkaloid fundamental parent (CHEBI:38482) |
| IUPAC Name |
|---|
| curan |
| Registry Numbers | Sources |
|---|---|
| Beilstein:891201 | Beilstein |