EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N2O |
| Net Charge | 0 |
| Average Mass | 282.387 |
| Monoisotopic Mass | 282.17321 |
| SMILES | [H][C@@]12COC=C[C@@]1([H])C[C@]1([H])N(CC[C@]13CNc1ccccc13)C2 |
| InChI | InChI=1S/C18H22N2O/c1-2-4-16-15(3-1)18(12-19-16)6-7-20-10-14-11-21-8-5-13(14)9-17(18)20/h1-5,8,13-14,17,19H,6-7,9-12H2/t13-,14+,17-,18+/m0/s1 |
| InChIKey | SSEMHSZOXZYLBH-IHETXDGRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| formosanan (CHEBI:35946) is a indole alkaloid (CHEBI:38958) |
| formosanan (CHEBI:35946) is a indole alkaloid fundamental parent (CHEBI:38482) |
| IUPAC Name |
|---|
| formosanan |