EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:35940 - protirelin
| Formula | C16H22N6O4 |
| Net Charge | 0 |
| Average Mass | 362.390 |
| Monoisotopic Mass | 362.17025 |
| SMILES | NC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc1cncn1)NC(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C16H22N6O4/c17-14(24)12-2-1-5-22(12)16(26)11(6-9-7-18-8-19-9)21-15(25)10-3-4-13(23)20-10/h7-8,10-12H,1-6H2,(H2,17,24)(H,18,19)(H,20,23)(H,21,25)/t10-,11-,12-/m0/s1 |
| InChIKey | XNSAINXGIQZQOO-SRVKXCTJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protirelin (CHEBI:35940) has role human metabolite (CHEBI:77746) |
| protirelin (CHEBI:35940) is a peptide hormone (CHEBI:25905) |
| protirelin (CHEBI:35940) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| 5-oxo-L-prolyl-L-histidyl-L-prolinamide |
| Synonyms | Source |
|---|---|
| Thyrotropin releasing hormone | KEGG COMPOUND |
| TRH | KEGG COMPOUND |
| Protirelin | KEGG COMPOUND |
| L-Pyroglutamyl-L-histidyl-L-prolineamide | ChemIDplus |
| Thyrotropin-releasing factor | ChemIDplus |
| Thyrotropic releasing hormone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C03958 | KEGG COMPOUND |
| Protirelin | Wikipedia |
| D00176 | KEGG DRUG |
| HMDB0005763 | HMDB |
| 2316 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:903432 | Reaxys |
| CAS:24305-27-9 | KEGG COMPOUND |
| CAS:24305-27-9 | ChemIDplus |
| Citations |
|---|