EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22N6O4 |
| Net Charge | 0 |
| Average Mass | 362.390 |
| Monoisotopic Mass | 362.17025 |
| SMILES | NC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc1cncn1)NC(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C16H22N6O4/c17-14(24)12-2-1-5-22(12)16(26)11(6-9-7-18-8-19-9)21-15(25)10-3-4-13(23)20-10/h7-8,10-12H,1-6H2,(H2,17,24)(H,18,19)(H,20,23)(H,21,25)/t10-,11-,12-/m0/s1 |
| InChIKey | XNSAINXGIQZQOO-SRVKXCTJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protirelin (CHEBI:35940) has role antineoplastic agent (CHEBI:35610) |
| protirelin (CHEBI:35940) has role human metabolite (CHEBI:77746) |
| protirelin (CHEBI:35940) is a peptide hormone (CHEBI:25905) |
| protirelin (CHEBI:35940) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| 5-oxo-L-prolyl-L-histidyl-L-prolinamide |
| INNs | Source |
|---|---|
| protirelina | WHO MedNet |
| protireline | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-oxo-pro-his-pro-nh2 | ChEMBL |
| A-38579 | ChEMBL |
| ABBOTT-38579 | ChEMBL |
| L-Pyroglutamyl-L-histidyl-L-prolineamide | ChemIDplus |
| NSC-760113 | ChEMBL |
| Protirelin | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Thypinone | ChEMBL |
| Thyrel trh | ChEMBL |
| Trh-cambridge | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2316 | DrugCentral |
| C03958 | KEGG COMPOUND |
| D00176 | KEGG DRUG |
| HMDB0005763 | HMDB |
| Protirelin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:903432 | Reaxys |
| CAS:24305-27-9 | KEGG COMPOUND |
| CAS:24305-27-9 | ChemIDplus |
| Citations |
|---|