EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O12 |
| Net Charge | 0 |
| Average Mass | 474.374 |
| Monoisotopic Mass | 474.07983 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H](C(=O)O)[C@@H](OC(=O)/C=C/c1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C22H18O12/c23-13-5-1-11(9-15(13)25)3-7-17(27)33-19(21(29)30)20(22(31)32)34-18(28)8-4-12-2-6-14(24)16(26)10-12/h1-10,19-20,23-26H,(H,29,30)(H,31,32)/b7-3+,8-4+/t19-,20-/m1/s1 |
| InChIKey | YDDGKXBLOXEEMN-IABMMNSOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chicoric acid (CHEBI:3594) has functional parent tetracarboxylic acid (CHEBI:35742) |
| chicoric acid (CHEBI:3594) has role geroprotector (CHEBI:176497) |
| chicoric acid (CHEBI:3594) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| chicoric acid (CHEBI:3594) is a organooxygen compound (CHEBI:36963) |
| IUPAC Name |
|---|
| (2R,3R)-2,3-bis{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}butanedioic acid |
| Synonyms | Source |
|---|---|
| Chicoric acid | KEGG COMPOUND |
| dicaffeoyltartaric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00002723 | KNApSAcK |
| C10437 | KEGG COMPOUND |
| Cichoric_acid | Wikipedia |
| FDB012144 | FooDB |
| GKP | PDBeChem |
| HMDB0002375 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:70831-56-0 | ChemIDplus |
| Citations |
|---|