EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H43NO17 |
| Net Charge | 0 |
| Average Mass | 761.730 |
| Monoisotopic Mass | 761.25310 |
| SMILES | [H][C@@]1(OC(C)=O)[C@]2([H])C(=O)[C@@H](OC(C)=O)[C@]3(COC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@]4([H])OC(=O)[C@@H](C)[C@H](C)c5ncccc5C(=O)OC[C@]2(C)O[C@@]31[C@@]4(C)O |
| InChI | InChI=1S/C36H43NO17/c1-15-16(2)31(44)53-29-26(49-18(4)39)30(52-21(7)42)35(14-47-17(3)38)28(51-20(6)41)25(43)23-27(50-19(5)40)36(35,34(29,9)46)54-33(23,8)13-48-32(45)22-11-10-12-37-24(15)22/h10-12,15-16,23,26-30,46H,13-14H2,1-9H3/t15-,16-,23-,26-,27+,28+,29-,30-,33-,34-,35+,36-/m0/s1 |
| InChIKey | IMIAGCONYJPMDY-MCLCTUEFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| evonine (CHEBI:35934) is a pyridine alkaloid (CHEBI:26416) |
| evonine (CHEBI:35934) is a pyridine alkaloid fundamental parent (CHEBI:38528) |
| Incoming Relation(s) |
| emarginatine B (CHEBI:65839) has functional parent evonine (CHEBI:35934) |
| emarginatine F (CHEBI:65840) has functional parent evonine (CHEBI:35934) |
| IUPAC Name |
|---|
| evonine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4946284 | Beilstein |
| CAS:33458-64-9 | ChemIDplus |